Calcium erythorbate

Calcium erythorbate

Names
IUPAC name Calcium 5-(1,2-dihydroxyethyl)-3-hydroxy-4-oxo-furan-2-olate
Other names Erythorbic acid, calcium salt; E318
Identifiers
CAS Number	99552-34-8
3D model (Jmol)	Interactive image
SMILES OC1=C([O-])[C@]([C@H](O)CO)([H])OC1=O.OC1=C([O-])[C@]([C@H](O)CO)([H])OC1=O.[Ca+2]
Properties
Chemical formula	Ca(C6H7O6)2
Molar mass	390.31 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y verify (what is YN ?)
Infobox references

Calcium erythorbate is a food additive. Chemically, it is the calcium salt of erythorbic acid, with the chemical formula Ca(C₆H₇O₆)₂. As an antioxidant structurally related to vitamin C, it helps improve flavor stability and prevents the formation of carcinogenic nitrosamines.

References