Decarboxylated 8,5'-diferulic acid
Decarboxylated 8,5'-diferulic acid
|
Names |
Other names
8,5'-DiFA (DC) 8,5'-diFA (decarboxylated form) |
Identifiers |
3D model (Jmol) |
Interactive image |
ChemSpider |
8512879 |
PubChem |
10337420 |
InChI=1S/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ Key: SLIMCXCSQXYCGL-JENUQAQBSA-N InChI=1/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ Key: SLIMCXCSQXYCGL-JENUQAQBBX
|
Oc2c(OC)cc(\C=C\C(O)=O)cc2\C=C\c(cc1OC)ccc1O
|
Properties |
|
C19H18O6 |
Molar mass |
342.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
Decarboxylated 8,5'-diferulic acid is a molecule included in the group but is not a true diferulic acid. It is found in maize bran.[1]
See also
References
- ↑ Bunzel, M; Funk, C; Steinhart, H (2004). "Semipreparative isolation of dehydrodiferulic and dehydrotriferulic acids as standard substances from maize bran". Journal of separation science. 27 (13): 1080–6. doi:10.1002/jssc.200301703. PMID 15495409.
|
---|
|
Aglycones | Precursor | |
---|
| Monohydroxycinnamic acids (Coumaric acids) | |
---|
| | |
---|
| Trihydroxycinnamic acids | |
---|
| O-methylated forms | |
---|
| others | |
---|
|
---|
|
Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
---|
| esters of shikimic acid | |
---|
|
---|
| Glycosides | |
---|
|
---|
| Tartaric acid esters | |
---|
| Other esters with caffeic acid | |
---|
| Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C and F
- Chiritoside A, B and C
- Cistanoside A, B, C, D, E, F, G an H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
|
---|
|
---|
|
Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid, 8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
|
---|
| Trimers | |
---|
| Tetramers | |
---|
|
---|
|
Conjugates with coenzyme A (CoA) | |
---|