Trifucol
Trifucol
 |
Identifiers |
3D model (Jmol) |
Interactive image |
InChI=1S/C18H14O9/c19-6-1-8(21)14(9(22)2-6)16-12(25)5-13(26)17(18(16)27)15-10(23)3-7(20)4-11(15)24/h1-5,19-27H Key: COTZPIUJHGYKAQ-UHFFFAOYSA-N
|
C1=C(C(=C(C(=C1O)C2=C(C=C(C=C2O)O)O)O)C3=C(C=C(C=C3O)O)O)O
|
Properties |
|
C18H14O9 |
Molar mass |
374.29 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
Trifucol is a phlorotannin found in the brown algae Scytothamnus australis and Analipus japonicus.
References
|
---|
|
Monomer | |
---|
|
Fucols | |
---|
|
Phlorethols |
- Diphlorethol and diphlorethol A
- Triphloroethol A
- Tetraphlorethol A, B, C and E
- Pentaphlorethol-B
- Hexaphlorethol-A
|
---|
|
Fucophlorethols |
- Fucophlorethol A and B
- Fucodiphlorethol A, D and G
- Fucotriphlorethol-B, G and H
- Fucotetraphlorethol-B, J and K
- Fucopentaphlorethol-E
- Bisfucotriphlorethol-A
- Bisfucotetraphlorethol-A
- Bisfucopentaphlorethol-A and B
- Bisfucoheptaphlorethol-A
- Difucophlorethol-A
- Difucofucotriphlorethol-A and B
- Difucofucotetraphlorethol-A
- Terfucopentaphlorethol-A
- Terfucohexaphlorethol-A and B
- Terfucoheptaphlorethol-A
|
---|
|
Fuhalols | |
---|
|
Isofuhalols | |
---|
|
Eckols | |
---|
|
Halogenated phlorotannins | Bromotriphlorethol A1 |
---|